C11H7O3- — CID 134099844
3-hydroxy-5-oxo-2-phenylcyclopenta-1,3-dien-1-olate (PubChem CID 134099844) has the molecular formula C11H7O3- and a molecular weight of 187.17 g/mol. Its IUPAC name is 3-hydroxy-5-oxo-2-phenylcyclopenta-1,3-dien-1-olate.
| Compound Name | 3-hydroxy-5-oxo-2-phenylcyclopenta-1,3-dien-1-olate |
|---|---|
| PubChem CID | 134099844 |
| Molecular Formula | C11H7O3- |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-hydroxy-5-oxo-2-phenylcyclopenta-1,3-dien-1-olate |
| SMILES | O=C1C=C(O)C(c2ccccc2)=C1[O-] |
| InChI | InChI=1S/C11H8O3/c12-8-6-9(13)11(14)10(8)7-4-2-1-3-5-7/h1-6,12H,(H,13,14)/p-1 |
| InChIKey | LSFRMWBHAIQGGY-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |