C18H17Cl3N2S — CID 134109462
2-benzyl-N-(2,4,5-trichlorophenyl)pyrrolidine-1-carbothioamide (PubChem CID 134109462) has the molecular formula C18H17Cl3N2S and a molecular weight of 399.77 g/mol. Its IUPAC name is 2-benzyl-N-(2,4,5-trichlorophenyl)pyrrolidine-1-carbothioamide.
| Compound Name | 2-benzyl-N-(2,4,5-trichlorophenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134109462 |
| Molecular Formula | C18H17Cl3N2S |
| Molecular Weight | 399.77 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 2-benzyl-N-(2,4,5-trichlorophenyl)pyrrolidine-1-carbothioamide |
| SMILES | S=C(Nc1cc(Cl)c(Cl)cc1Cl)N1CCCC1Cc1ccccc1 |
| InChI | InChI=1S/C18H17Cl3N2S/c19-14-10-16(21)17(11-15(14)20)22-18(24)23-8-4-7-13(23)9-12-5-2-1-3-6-12/h1-3,5-6,10-11,13H,4,7-9H2,(H,22,24) |
| InChIKey | NWOXSOWRZHTSMI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|