C12H7ClF2N2O2 — CID 134113793
(5-chloro-2-pyridinyl) N-(2,5-difluorophenyl)carbamate (PubChem CID 134113793) has the molecular formula C12H7ClF2N2O2 and a molecular weight of 284.65 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl) N-(2,5-difluorophenyl)carbamate.
| Compound Name | (5-chloro-2-pyridinyl) N-(2,5-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 134113793 |
| Molecular Formula | C12H7ClF2N2O2 |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (5-chloro-2-pyridinyl) N-(2,5-difluorophenyl)carbamate |
| SMILES | O=C(Nc1cc(F)ccc1F)Oc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H7ClF2N2O2/c13-7-1-4-11(16-6-7)19-12(18)17-10-5-8(14)2-3-9(10)15/h1-6H,(H,17,18) |
| InChIKey | ZBWBFGXAKOFELX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |