C13H14N4 — CID 134120455
3-(4-aminophenyl)-2,3-diazabicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 134120455) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2,3-diazabicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | 3-(4-aminophenyl)-2,3-diazabicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 134120455 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-(4-aminophenyl)-2,3-diazabicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | N#CN1C2C=CC(CC2)N1c1ccc(N)cc1 |
| InChI | InChI=1S/C13H14N4/c14-9-16-11-5-7-13(8-6-11)17(16)12-3-1-10(15)2-4-12/h1-5,7,11,13H,6,8,15H2 |
| InChIKey | VXTDMBSREBGSFS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|