C27H39N7O — CID 134121905
N'-(3-amino-2,2-dimethylpropyl)-N-[4-(dimethylamino)phenyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide (PubChem CID 134121905) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is N'-(3-amino-2,2-dimethylpropyl)-N-[4-(dimethylamino)phenyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide.
| Compound Name | N'-(3-amino-2,2-dimethylpropyl)-N-[4-(dimethylamino)phenyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide |
|---|---|
| PubChem CID | 134121905 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | N'-(3-amino-2,2-dimethylpropyl)-N-[4-(dimethylamino)phenyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide |
| SMILES | CN(C)c1ccc(N/C(=N/CC(C)(C)CN)N2CCC3(CC2)C(=O)NCN3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H39N7O/c1-26(2,18-28)19-29-25(31-21-10-12-22(13-11-21)32(3)4)33-16-14-27(15-17-33)24(35)30-20-34(27)23-8-6-5-7-9-23/h5-13H,14-20,28H2,1-4H3,(H,29,31)(H,30,35) |
| InChIKey | CXSCLYHXVBKWFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|