C9H9N3O4 — CID 134125355
4-ethyl-7-nitropyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 134125355) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 4-ethyl-7-nitropyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-ethyl-7-nitropyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 134125355 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-ethyl-7-nitropyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CCN1C(=O)COc2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C9H9N3O4/c1-2-11-8(13)5-16-7-3-6(12(14)15)4-10-9(7)11/h3-4H,2,5H2,1H3 |
| InChIKey | HTYXHXDSRXAJHO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|