C24H17F6N5O5S — CID 134136518
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-nitrophenyl)triazol-4-yl]methyl]benzenesulfonamide (PubChem CID 134136518) has the molecular formula C24H17F6N5O5S and a molecular weight of 601.49 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-nitrophenyl)triazol-4-yl]methyl]benzenesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-nitrophenyl)triazol-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134136518 |
| Molecular Formula | C24H17F6N5O5S |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-[[1-(4-nitrophenyl)triazol-4-yl]methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(CN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)S(=O)(=O)c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C24H17F6N5O5S/c25-23(26,27)22(36,24(28,29)30)16-6-8-19(9-7-16)34(41(39,40)21-4-2-1-3-5-21)15-17-14-33(32-31-17)18-10-12-20(13-11-18)35(37)38/h1-14,36H,15H2 |
| InChIKey | YBQDFKDUAPYQKT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|