C43H57N5O3 — CID 134138967
(2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(dibenzylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide (PubChem CID 134138967) has the molecular formula C43H57N5O3 and a molecular weight of 691.96 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(dibenzylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide.
| Compound Name | (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(dibenzylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide |
|---|---|
| PubChem CID | 134138967 |
| Molecular Formula | C43H57N5O3 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.45 |
| IUPAC Name | (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(dibenzylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)CN(CC(=O)N(Cc1ccccc1)Cc1ccccc1)C(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H57N5O3/c44-19-11-10-18-39(45)42(51)46-38(23-32-12-4-1-5-13-32)30-48(40(49)27-43-24-35-20-36(25-43)22-37(21-35)26-43)31-41(50)47(28-33-14-6-2-7-15-33)29-34-16-8-3-9-17-34/h1-9,12-17,35-39H,10-11,18-31,44-45H2,(H,46,51)/t35?,36?,37?,38-,39-,43?/m0/s1 |
| InChIKey | BECKHXCJXXDMRN-WEASNXJDSA-N |
| XLogP | 5.83 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|