C40H61N5O3 — CID 134143244
(2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(1-adamantylmethylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide (PubChem CID 134143244) has the molecular formula C40H61N5O3 and a molecular weight of 659.96 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(1-adamantylmethylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide.
| Compound Name | (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(1-adamantylmethylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide |
|---|---|
| PubChem CID | 134143244 |
| Molecular Formula | C40H61N5O3 |
| Molecular Weight | 659.96 g/mol |
| Exact Mass | 659.48 |
| IUPAC Name | (2S)-N-[(2S)-1-[[2-(1-adamantyl)acetyl]-[2-(1-adamantylmethylamino)-2-oxoethyl]amino]-3-phenylpropan-2-yl]-2,6-diaminohexanamide |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)CN(CC(=O)NCC12CC3CC(CC(C3)C1)C2)C(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C40H61N5O3/c41-9-5-4-8-35(42)38(48)44-34(16-27-6-2-1-3-7-27)24-45(37(47)23-39-17-28-10-29(18-39)12-30(11-28)19-39)25-36(46)43-26-40-20-31-13-32(21-40)15-33(14-31)22-40/h1-3,6-7,28-35H,4-5,8-26,41-42H2,(H,43,46)(H,44,48)/t28?,29?,30?,31?,32?,33?,34-,35-,39?,40?/m0/s1 |
| InChIKey | OLOXSKDQCDVRIC-WQXNBULDSA-N |
| XLogP | 4.94 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|