C27H43N5O5S — CID 134142983
(2S)-3-(6-amino-3-pyridinyl)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]propanoic acid (PubChem CID 134142983) has the molecular formula C27H43N5O5S and a molecular weight of 549.74 g/mol. Its IUPAC name is (2S)-3-(6-amino-3-pyridinyl)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]propanoic acid.
| Compound Name | (2S)-3-(6-amino-3-pyridinyl)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]propanoic acid |
|---|---|
| PubChem CID | 134142983 |
| Molecular Formula | C27H43N5O5S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | (2S)-3-(6-amino-3-pyridinyl)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]propanoic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@H](CC1CCCCC1)NS(=O)(=O)N[C@@H](Cc1ccc(N)nc1)C(=O)O)C2 |
| InChI | InChI=1S/C27H43N5O5S/c1-26(2)19-11-12-27(26,3)22(15-19)30-24(33)20(13-17-7-5-4-6-8-17)31-38(36,37)32-21(25(34)35)14-18-9-10-23(28)29-16-18/h9-10,16-17,19-22,31-32H,4-8,11-15H2,1-3H3,(H2,28,29)(H,30,33)(H,34,35)/t19-,20+,21+,22+,27+/m1/s1 |
| InChIKey | QHXMEEQJYRVZQW-HKVSAHRDSA-N |
| XLogP | 2.75 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |