C15H6Cl5N3OS — CID 134152144
1-(3,5-dichlorophenyl)-4-imino-5-sulfanylidene-3-(2,4,5-trichlorophenyl)imidazolidin-2-one (PubChem CID 134152144) has the molecular formula C15H6Cl5N3OS and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-4-imino-5-sulfanylidene-3-(2,4,5-trichlorophenyl)imidazolidin-2-one.
| Compound Name | 1-(3,5-dichlorophenyl)-4-imino-5-sulfanylidene-3-(2,4,5-trichlorophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 134152144 |
| Molecular Formula | C15H6Cl5N3OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 450.87 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-4-imino-5-sulfanylidene-3-(2,4,5-trichlorophenyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\C(=S)N(c2cc(Cl)cc(Cl)c2)C(=O)N1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H6Cl5N3OS/c16-6-1-7(17)3-8(2-6)22-14(25)13(21)23(15(22)24)12-5-10(19)9(18)4-11(12)20/h1-5,21H/b21-13+ |
| InChIKey | FXUPNZZLLDSLCM-FYJGNVAPSA-N |
| XLogP | 6.70 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|