C12H23N3S — CID 134156902
2-cyclohexyl-5,5-diethyl-1,2,4-triazolidine-3-thione (PubChem CID 134156902) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 2-cyclohexyl-5,5-diethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 2-cyclohexyl-5,5-diethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 134156902 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-cyclohexyl-5,5-diethyl-1,2,4-triazolidine-3-thione |
| SMILES | CCC1(CC)NC(=S)N(C2CCCCC2)N1 |
| InChI | InChI=1S/C12H23N3S/c1-3-12(4-2)13-11(16)15(14-12)10-8-6-5-7-9-10/h10,14H,3-9H2,1-2H3,(H,13,16) |
| InChIKey | XZSASKRWYWLXAZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|