C18H22F2O4 — CID 134183878
(4R,5R,6aS)-4-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 134183878) has the molecular formula C18H22F2O4 and a molecular weight of 340.37 g/mol. Its IUPAC name is (4R,5R,6aS)-4-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (4R,5R,6aS)-4-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 134183878 |
| Molecular Formula | C18H22F2O4 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (4R,5R,6aS)-4-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | OCC1CC2[C@H](C[C@@H](O)[C@@H]2/C=C/C(F)(F)COc2ccccc2)O1 |
| InChI | InChI=1S/C18H22F2O4/c19-18(20,11-23-12-4-2-1-3-5-12)7-6-14-15-8-13(10-21)24-17(15)9-16(14)22/h1-7,13-17,21-22H,8-11H2/b7-6+/t13?,14-,15?,16-,17+/m1/s1 |
| InChIKey | PAGQQZKYEJAGEG-IQHMQPKUSA-N |
| XLogP | 2.40 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|