C30H38N2O4 — CID 134185168
(1S,5R,10S,11S,15S,21R)-7-hydroxy-1,8,8,15,20,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5,18-dicarbonitrile (PubChem CID 134185168) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is (1S,5R,10S,11S,15S,21R)-7-hydroxy-1,8,8,15,20,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5,18-dicarbonitrile.
| Compound Name | (1S,5R,10S,11S,15S,21R)-7-hydroxy-1,8,8,15,20,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5,18-dicarbonitrile |
|---|---|
| PubChem CID | 134185168 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (1S,5R,10S,11S,15S,21R)-7-hydroxy-1,8,8,15,20,20-hexamethyl-12,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-ene-5,18-dicarbonitrile |
| SMILES | CC1(C)C[C@H]2[C@H]3C(=O)C=C4[C@@]5(C)C6OC6(C#N)C(=O)C(C)(C)[C@@H]5CC[C@@]4(C)C3CC[C@@]2(C#N)CC1O |
| InChI | InChI=1S/C30H38N2O4/c1-25(2)12-17-22-16(7-10-29(17,14-31)13-21(25)34)27(5)9-8-19-26(3,4)23(35)30(15-32)24(36-30)28(19,6)20(27)11-18(22)33/h11,16-17,19,21-22,24,34H,7-10,12-13H2,1-6H3/t16?,17-,19-,21?,22-,24?,27-,28-,29-,30?/m0/s1 |
| InChIKey | HQYSHIVNOULVFT-LTTMUESISA-N |
| XLogP | 4.52 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|