C31H35N3O3 — CID 134189189
4-[(2S)-21-(cyclopropylmethyl)-16-hydroxy-5,21-diazaheptacyclo[9.7.3.13,10.01,10.02,6.03,8.013,18]docosa-13(18),14,16-triene-5-carbonyl]-1-methylpyridin-2-one (PubChem CID 134189189) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-[(2S)-21-(cyclopropylmethyl)-16-hydroxy-5,21-diazaheptacyclo[9.7.3.13,10.01,10.02,6.03,8.013,18]docosa-13(18),14,16-triene-5-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 4-[(2S)-21-(cyclopropylmethyl)-16-hydroxy-5,21-diazaheptacyclo[9.7.3.13,10.01,10.02,6.03,8.013,18]docosa-13(18),14,16-triene-5-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 134189189 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 4-[(2S)-21-(cyclopropylmethyl)-16-hydroxy-5,21-diazaheptacyclo[9.7.3.13,10.01,10.02,6.03,8.013,18]docosa-13(18),14,16-triene-5-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(C(=O)N2CC34CC56CC3CC2[C@H]4C52CCN(CC3CC3)C6Cc3ccc(O)cc32)cc1=O |
| InChI | InChI=1S/C31H35N3O3/c1-32-8-6-20(11-26(32)36)28(37)34-17-29-16-30-14-21(29)12-24(34)27(29)31(30)7-9-33(15-18-2-3-18)25(30)10-19-4-5-22(35)13-23(19)31/h4-6,8,11,13,18,21,24-25,27,35H,2-3,7,9-10,12,14-17H2,1H3/t21?,24?,25?,27-,29?,30?,31?/m1/s1 |
| InChIKey | BCDXMQNNQVDAPO-PQIJNDOKSA-N |
| XLogP | 3.31 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |