C38H44O8 — CID 134201044
2-[5-cyclohexyl-2-[4-[4-(2-hydroxyethoxy)phenyl]phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134201044) has the molecular formula C38H44O8 and a molecular weight of 628.76 g/mol. Its IUPAC name is 2-[5-cyclohexyl-2-[4-[4-(2-hydroxyethoxy)phenyl]phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-cyclohexyl-2-[4-[4-(2-hydroxyethoxy)phenyl]phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134201044 |
| Molecular Formula | C38H44O8 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 2-[5-cyclohexyl-2-[4-[4-(2-hydroxyethoxy)phenyl]phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(C2CCCCC2)c(OCCOC(=O)C(=C)C)cc1-c1ccc(-c2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C38H44O8/c1-26(2)37(40)45-22-20-43-35-25-34(31-12-10-28(11-13-31)29-14-16-32(17-15-29)42-19-18-39)36(44-21-23-46-38(41)27(3)4)24-33(35)30-8-6-5-7-9-30/h10-17,24-25,30,39H,1,3,5-9,18-23H2,2,4H3 |
| InChIKey | RTJHPSKAVKATNL-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|