C20H41N — CID 134218388
2,3,6,7,11-pentamethyl-5-propan-2-yldodec-1-en-4-amine (PubChem CID 134218388) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is 2,3,6,7,11-pentamethyl-5-propan-2-yldodec-1-en-4-amine.
| Compound Name | 2,3,6,7,11-pentamethyl-5-propan-2-yldodec-1-en-4-amine |
|---|---|
| PubChem CID | 134218388 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | 2,3,6,7,11-pentamethyl-5-propan-2-yldodec-1-en-4-amine |
| SMILES | C=C(C)C(C)C(N)C(C(C)C)C(C)C(C)CCCC(C)C |
| InChI | InChI=1S/C20H41N/c1-13(2)11-10-12-16(7)18(9)19(15(5)6)20(21)17(8)14(3)4/h13,15-20H,3,10-12,21H2,1-2,4-9H3 |
| InChIKey | MRGYWIHCNFNDIK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|