C10H9F2N3O — CID 134221425
4-azido-3-(difluoromethyl)-3,4-dihydro-1H-isochromene (PubChem CID 134221425) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 4-azido-3-(difluoromethyl)-3,4-dihydro-1H-isochromene.
| Compound Name | 4-azido-3-(difluoromethyl)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 134221425 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-azido-3-(difluoromethyl)-3,4-dihydro-1H-isochromene |
| SMILES | [N-]=[N+]=NC1c2ccccc2COC1C(F)F |
| InChI | InChI=1S/C10H9F2N3O/c11-10(12)9-8(14-15-13)7-4-2-1-3-6(7)5-16-9/h1-4,8-10H,5H2 |
| InChIKey | UISQVVIZSZMOAL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|