C14H19NO6 — CID 134227320
2-(ethylcarbamoyloxy)ethyl 2-ethenyl-1-ethoxy-3-(oxomethylidene)cyclopropane-1-carboxylate (PubChem CID 134227320) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(ethylcarbamoyloxy)ethyl 2-ethenyl-1-ethoxy-3-(oxomethylidene)cyclopropane-1-carboxylate.
| Compound Name | 2-(ethylcarbamoyloxy)ethyl 2-ethenyl-1-ethoxy-3-(oxomethylidene)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134227320 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(ethylcarbamoyloxy)ethyl 2-ethenyl-1-ethoxy-3-(oxomethylidene)cyclopropane-1-carboxylate |
| SMILES | C=CC1C(=C=O)C1(OCC)C(=O)OCCOC(=O)NCC |
| InChI | InChI=1S/C14H19NO6/c1-4-10-11(9-16)14(10,21-6-3)12(17)19-7-8-20-13(18)15-5-2/h4,10H,1,5-8H2,2-3H3,(H,15,18) |
| InChIKey | KQUMVGNEVHHARI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|