C9H8N4S — CID 13423192
3-methylsulfanyl-6-pyridin-2-yl-1,2,4-triazine (PubChem CID 13423192) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 3-methylsulfanyl-6-pyridin-2-yl-1,2,4-triazine.
| Compound Name | 3-methylsulfanyl-6-pyridin-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 13423192 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-methylsulfanyl-6-pyridin-2-yl-1,2,4-triazine |
| SMILES | CSc1ncc(-c2ccccn2)nn1 |
| InChI | InChI=1S/C9H8N4S/c1-14-9-11-6-8(12-13-9)7-4-2-3-5-10-7/h2-6H,1H3 |
| InChIKey | NXZSGCJNGURQKC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |