C8H7F2IO5S — CID 134237661
1,1-difluoro-2-(3-hydroxy-2-iodophenoxy)ethanesulfonic acid (PubChem CID 134237661) has the molecular formula C8H7F2IO5S and a molecular weight of 380.11 g/mol. Its IUPAC name is 1,1-difluoro-2-(3-hydroxy-2-iodophenoxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(3-hydroxy-2-iodophenoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 134237661 |
| Molecular Formula | C8H7F2IO5S |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 1,1-difluoro-2-(3-hydroxy-2-iodophenoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)COc1cccc(O)c1I |
| InChI | InChI=1S/C8H7F2IO5S/c9-8(10,17(13,14)15)4-16-6-3-1-2-5(12)7(6)11/h1-3,12H,4H2,(H,13,14,15) |
| InChIKey | WBVJINCHTFYFPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|