C30H42F2O3 — CID 134245232
[1-[4-[4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexyl]cyclohexyl]-4-hydroxybutan-2-yl] 2-methylprop-2-enoate (PubChem CID 134245232) has the molecular formula C30H42F2O3 and a molecular weight of 488.66 g/mol. Its IUPAC name is [1-[4-[4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexyl]cyclohexyl]-4-hydroxybutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[4-[4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexyl]cyclohexyl]-4-hydroxybutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134245232 |
| Molecular Formula | C30H42F2O3 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [1-[4-[4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexyl]cyclohexyl]-4-hydroxybutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCO)CC1CCC(C2CCC(c3ccc(CCC=C(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H42F2O3/c1-21(2)30(34)35-28(18-19-33)20-23-8-12-25(13-9-23)27-16-14-26(15-17-27)24-10-6-22(7-11-24)4-3-5-29(31)32/h5-7,10-11,23,25-28,33H,1,3-4,8-9,12-20H2,2H3 |
| InChIKey | YCRUHZQPUJNTMK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|