C16H18F2O — CID 20599818
4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexan-1-one (PubChem CID 20599818) has the molecular formula C16H18F2O and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexan-1-one.
| Compound Name | 4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 20599818 |
| Molecular Formula | C16H18F2O |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[4-(4,4-difluorobut-3-enyl)phenyl]cyclohexan-1-one |
| SMILES | O=C1CCC(c2ccc(CCC=C(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F2O/c17-16(18)3-1-2-12-4-6-13(7-5-12)14-8-10-15(19)11-9-14/h3-7,14H,1-2,8-11H2 |
| InChIKey | VLPJMSSKRLZBHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |