C22H19F5 — CID 134254273
1,3-difluoro-5-(4-methylphenyl)-2-[(2E,4Z)-3,4,5-trifluoro-7-methylocta-2,4,6-trienyl]benzene (PubChem CID 134254273) has the molecular formula C22H19F5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-methylphenyl)-2-[(2E,4Z)-3,4,5-trifluoro-7-methylocta-2,4,6-trienyl]benzene.
| Compound Name | 1,3-difluoro-5-(4-methylphenyl)-2-[(2E,4Z)-3,4,5-trifluoro-7-methylocta-2,4,6-trienyl]benzene |
|---|---|
| PubChem CID | 134254273 |
| Molecular Formula | C22H19F5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1,3-difluoro-5-(4-methylphenyl)-2-[(2E,4Z)-3,4,5-trifluoro-7-methylocta-2,4,6-trienyl]benzene |
| SMILES | CC(C)=C/C(F)=C(F)\C(F)=C/Cc1c(F)cc(-c2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C22H19F5/c1-13(2)10-21(26)22(27)18(23)9-8-17-19(24)11-16(12-20(17)25)15-6-4-14(3)5-7-15/h4-7,9-12H,8H2,1-3H3/b18-9+,22-21- |
| InChIKey | AACRERIKCUNBDV-MOTNVCRKSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|