C25H26F2O4 — CID 141445640
2-(3,4-difluorophenyl)-6,8-bis(3-methylbut-2-enyl)-4H-chromene-3,5,7-triol (PubChem CID 141445640) has the molecular formula C25H26F2O4 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-6,8-bis(3-methylbut-2-enyl)-4H-chromene-3,5,7-triol.
| Compound Name | 2-(3,4-difluorophenyl)-6,8-bis(3-methylbut-2-enyl)-4H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 141445640 |
| Molecular Formula | C25H26F2O4 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(3,4-difluorophenyl)-6,8-bis(3-methylbut-2-enyl)-4H-chromene-3,5,7-triol |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)CC(O)=C(c1ccc(F)c(F)c1)O2 |
| InChI | InChI=1S/C25H26F2O4/c1-13(2)5-8-16-22(29)17(9-6-14(3)4)25-18(23(16)30)12-21(28)24(31-25)15-7-10-19(26)20(27)11-15/h5-7,10-11,28-30H,8-9,12H2,1-4H3 |
| InChIKey | HSOBRKPMXIBYJZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|