C26H29FO5 — CID 141291782
2-(3-fluoro-4-hydroxyphenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol (PubChem CID 141291782) has the molecular formula C26H29FO5 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxyphenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol.
| Compound Name | 2-(3-fluoro-4-hydroxyphenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol |
|---|---|
| PubChem CID | 141291782 |
| Molecular Formula | C26H29FO5 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-(3-fluoro-4-hydroxyphenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol |
| SMILES | COC1=C(c2ccc(O)c(F)c2)Oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2C1 |
| InChI | InChI=1S/C26H29FO5/c1-14(2)6-9-17-23(29)18(10-7-15(3)4)26-19(24(17)30)13-22(31-5)25(32-26)16-8-11-21(28)20(27)12-16/h6-8,11-12,28-30H,9-10,13H2,1-5H3 |
| InChIKey | ABCXRGZNBFWOTQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|