C20H21FO2 — CID 141326802
5-(2-ethenyl-6-fluorophenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol (PubChem CID 141326802) has the molecular formula C20H21FO2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 5-(2-ethenyl-6-fluorophenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol.
| Compound Name | 5-(2-ethenyl-6-fluorophenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol |
|---|---|
| PubChem CID | 141326802 |
| Molecular Formula | C20H21FO2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-(2-ethenyl-6-fluorophenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol |
| SMILES | C=Cc1cccc(F)c1-c1cc(O)c(CC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C20H21FO2/c1-5-14-7-6-8-17(21)20(14)15-11-18(22)16(10-9-13(2)3)19(12-15)23-4/h5-9,11-12,22H,1,10H2,2-4H3 |
| InChIKey | IIQAEIBPJRQEOM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|