C25H23ClN4O2 — CID 134276267
tert-butyl N-[8-(3-aminophenyl)-6-(2-chlorophenyl)quinazolin-2-yl]carbamate (PubChem CID 134276267) has the molecular formula C25H23ClN4O2 and a molecular weight of 446.94 g/mol. Its IUPAC name is tert-butyl N-[8-(3-aminophenyl)-6-(2-chlorophenyl)quinazolin-2-yl]carbamate.
| Compound Name | tert-butyl N-[8-(3-aminophenyl)-6-(2-chlorophenyl)quinazolin-2-yl]carbamate |
|---|---|
| PubChem CID | 134276267 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | tert-butyl N-[8-(3-aminophenyl)-6-(2-chlorophenyl)quinazolin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc2cc(-c3ccccc3Cl)cc(-c3cccc(N)c3)c2n1 |
| InChI | InChI=1S/C25H23ClN4O2/c1-25(2,3)32-24(31)30-23-28-14-17-11-16(19-9-4-5-10-21(19)26)13-20(22(17)29-23)15-7-6-8-18(27)12-15/h4-14H,27H2,1-3H3,(H,28,29,30,31) |
| InChIKey | OHJKTZQRQFOAGR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|