C23H20Cl2N4O2 — CID 90745113
2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate (PubChem CID 90745113) has the molecular formula C23H20Cl2N4O2 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate |
|---|---|
| PubChem CID | 90745113 |
| Molecular Formula | C23H20Cl2N4O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate |
| SMILES | CN(C)CCOC(=O)Nc1ncc2cc(-c3ccc(Cl)c(Cl)c3)c3ccccc3c2n1 |
| InChI | InChI=1S/C23H20Cl2N4O2/c1-29(2)9-10-31-23(30)28-22-26-13-15-11-18(14-7-8-19(24)20(25)12-14)16-5-3-4-6-17(16)21(15)27-22/h3-8,11-13H,9-10H2,1-2H3,(H,26,27,28,30) |
| InChIKey | FKAVHBGRGCYCIE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|