About 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate
2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate (PubChem CID 90745113) has the molecular formula C23H20Cl2N4O2
and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate |
| PubChem CID | 90745113 |
| Molecular Formula | C23H20Cl2N4O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate |
| SMILES | CN(C)CCOC(=O)Nc1ncc2cc(-c3ccc(Cl)c(Cl)c3)c3ccccc3c2n1 |
| InChI | InChI=1S/C23H20Cl2N4O2/c1-29(2)9-10-31-23(30)28-22-26-13-15-11-18(14-7-8-19(24)20(25)12-14)16-5-3-4-6-17(16)21(15)27-22/h3-8,11-13H,9-10H2,1-2H3,(H,26,27,28,30) |
| InChIKey | FKAVHBGRGCYCIE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate?
The IUPAC name of 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate (CID 90745113) is 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate.
What is the SMILES notation for 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate?
The canonical SMILES for 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate is CN(C)CCOC(=O)Nc1ncc2cc(-c3ccc(Cl)c(Cl)c3)c3ccccc3c2n1.
What is the InChIKey of 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate?
The InChIKey is FKAVHBGRGCYCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2N4O2/c1-29(2)9-10-31-23(30)28-22-26-13-15-11-18(14-7-8-19(24)20(25)12-14)16-5-3-4-6-17(16)21(15)27-22/h3-8,11-13H,9-10H2,1-2H3,(H,26,27,28,30).
What are the key properties of 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate?
2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate has a molecular weight of 455.35 g/mol, XLogP of 5.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N-[6-(3,4-dichlorophenyl)benzo[h]quinazolin-2-yl]carbamate is sourced from PubChem (CID 90745113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).