C12H19F8NO — CID 134276376
N-methyl-N-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]butan-1-amine (PubChem CID 134276376) has the molecular formula C12H19F8NO and a molecular weight of 345.27 g/mol. Its IUPAC name is N-methyl-N-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]butan-1-amine.
| Compound Name | N-methyl-N-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 134276376 |
| Molecular Formula | C12H19F8NO |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-methyl-N-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]butan-1-amine |
| SMILES | CCCCN(C)CCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H19F8NO/c1-3-4-5-21(2)6-7-22-8-10(15,16)12(19,20)11(17,18)9(13)14/h9H,3-8H2,1-2H3 |
| InChIKey | WDNSVLBVAUPKNB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|