C32H39N3O4S — CID 134280492
tert-butyl 3-[(S)-[[(R)-tert-butylsulfinyl]amino]-[2-(2-phenylmethoxyethyl)phenyl]methyl]indazole-1-carboxylate (PubChem CID 134280492) has the molecular formula C32H39N3O4S and a molecular weight of 561.75 g/mol. Its IUPAC name is tert-butyl 3-[(S)-[[(R)-tert-butylsulfinyl]amino]-[2-(2-phenylmethoxyethyl)phenyl]methyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(S)-[[(R)-tert-butylsulfinyl]amino]-[2-(2-phenylmethoxyethyl)phenyl]methyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 134280492 |
| Molecular Formula | C32H39N3O4S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | tert-butyl 3-[(S)-[[(R)-tert-butylsulfinyl]amino]-[2-(2-phenylmethoxyethyl)phenyl]methyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc([C@@H](N[S@](=O)C(C)(C)C)c2ccccc2CCOCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H39N3O4S/c1-31(2,3)39-30(36)35-27-19-13-12-18-26(27)28(33-35)29(34-40(37)32(4,5)6)25-17-11-10-16-24(25)20-21-38-22-23-14-8-7-9-15-23/h7-19,29,34H,20-22H2,1-6H3/t29-,40+/m0/s1 |
| InChIKey | IOTYJBHAFVOYPI-XJDVZLJJSA-N |
| XLogP | 6.72 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|