C36H44N4P+ — CID 134286118
4,5,9,10,14,15,19,20-octaethyl-2,22,23,25-tetraza-1-phosphoniaoctacyclo[11.9.1.11,8.13,21.02,6.016,23.018,22.011,25]pentacosa-3(24),4,6,8,10,12,14,16,18,20-decaene (PubChem CID 134286118) has the molecular formula C36H44N4P+ and a molecular weight of 563.75 g/mol. Its IUPAC name is 4,5,9,10,14,15,19,20-octaethyl-2,22,23,25-tetraza-1-phosphoniaoctacyclo[11.9.1.11,8.13,21.02,6.016,23.018,22.011,25]pentacosa-3(24),4,6,8,10,12,14,16,18,20-decaene.
| Compound Name | 4,5,9,10,14,15,19,20-octaethyl-2,22,23,25-tetraza-1-phosphoniaoctacyclo[11.9.1.11,8.13,21.02,6.016,23.018,22.011,25]pentacosa-3(24),4,6,8,10,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 134286118 |
| Molecular Formula | C36H44N4P+ |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | 4,5,9,10,14,15,19,20-octaethyl-2,22,23,25-tetraza-1-phosphoniaoctacyclo[11.9.1.11,8.13,21.02,6.016,23.018,22.011,25]pentacosa-3(24),4,6,8,10,12,14,16,18,20-decaene |
| SMILES | CCc1c(CC)c2n3c1C=c1c(CC)c(CC)c4n1[P+]31n3c(c(CC)c(CC)c3C=c3c(CC)c(CC)c(n31)=C2)C=4 |
| InChI | InChI=1S/C36H44N4P/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34-20-36-28(16-8)27(15-7)35-19-33-24(12-4)23(11-3)31-17-29(21)37(30)41(38(31)33,39(32)34)40(35)36/h17-20H,9-16H2,1-8H3/q+1 |
| InChIKey | QFMAHDJEIGTVMT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|