C26H21FN2O3S — CID 134288119
ethanimidoyl (E)-3-[4-[[2-(4-fluoro-2-methylphenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enimidate (PubChem CID 134288119) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is ethanimidoyl (E)-3-[4-[[2-(4-fluoro-2-methylphenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enimidate.
| Compound Name | ethanimidoyl (E)-3-[4-[[2-(4-fluoro-2-methylphenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enimidate |
|---|---|
| PubChem CID | 134288119 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethanimidoyl (E)-3-[4-[[2-(4-fluoro-2-methylphenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enimidate |
| SMILES | [H]/N=C(/C=C/c1ccc(Oc2c(-c3ccc(F)cc3C)sc3cc(O)ccc23)cc1)O/C(C)=N/[H] |
| InChI | InChI=1S/C26H21FN2O3S/c1-15-13-18(27)6-10-21(15)26-25(22-11-7-19(30)14-23(22)33-26)32-20-8-3-17(4-9-20)5-12-24(29)31-16(2)28/h3-14,28-30H,1-2H3/b12-5+,28-16+,29-24- |
| InChIKey | JVBRWHNAJBVZMA-XINZIFCHSA-N |
| XLogP | 7.52 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|