C19H17F3N4O3 — CID 134290255
3-(4,5-dimethoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134290255) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(4,5-dimethoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134290255 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)cnn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C19H17F3N4O3/c1-10-4-15(28-2)16(29-3)7-14(10)24-19-25-17(27)8-23-26(19)9-11-5-12(20)18(22)13(21)6-11/h4-8H,9H2,1-3H3,(H,24,25,27) |
| InChIKey | XOYNUWMKKGUOOZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|