C20H17F3N4O5 — CID 134290171
3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid (PubChem CID 134290171) has the molecular formula C20H17F3N4O5 and a molecular weight of 450.37 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 134290171 |
| Molecular Formula | C20H17F3N4O5 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid |
| SMILES | COc1cc(C)c(Nc2nc(=O)c(C(=O)O)nn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H17F3N4O5/c1-9-4-14(31-2)15(32-3)7-13(9)24-20-25-18(28)17(19(29)30)26-27(20)8-10-5-11(21)16(23)12(22)6-10/h4-7H,8H2,1-3H3,(H,29,30)(H,24,25,28) |
| InChIKey | VYWIYMMUWXZZRG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|