C20H18F3N3O3 — CID 134291278
2-(4,5-dimethoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291278) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-(4,5-dimethoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291278 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)ccn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H18F3N3O3/c1-11-6-16(28-2)17(29-3)9-15(11)24-20-25-18(27)4-5-26(20)10-12-7-13(21)19(23)14(22)8-12/h4-9H,10H2,1-3H3,(H,24,25,27) |
| InChIKey | IJQVTQGVYUWUFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|