C22H19F3N4O2 — CID 134291516
5-(methoxymethyl)-2-[(4-methyl-1H-indol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291516) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 5-(methoxymethyl)-2-[(4-methyl-1H-indol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-(methoxymethyl)-2-[(4-methyl-1H-indol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291516 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 5-(methoxymethyl)-2-[(4-methyl-1H-indol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | COCc1cn(Cc2cc(F)c(F)c(F)c2)c(Nc2ccc3[nH]ccc3c2C)nc1=O |
| InChI | InChI=1S/C22H19F3N4O2/c1-12-15-5-6-26-19(15)4-3-18(12)27-22-28-21(30)14(11-31-2)10-29(22)9-13-7-16(23)20(25)17(24)8-13/h3-8,10,26H,9,11H2,1-2H3,(H,27,28,30) |
| InChIKey | PCNQMKSNFWHDAM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|