C24H30N6O3S — CID 134293482
N-methyl-1-[6-(4-methylsulfanyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-4-yl]benzimidazol-2-amine (PubChem CID 134293482) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-methyl-1-[6-(4-methylsulfanyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-4-yl]benzimidazol-2-amine.
| Compound Name | N-methyl-1-[6-(4-methylsulfanyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 134293482 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | N-methyl-1-[6-(4-methylsulfanyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
| SMILES | CNc1nc2ccccc2n1-c1nc2c(c(C3(SC)CCOCC3)n1)OCCC1COCCN21 |
| InChI | InChI=1S/C24H30N6O3S/c1-25-22-26-17-5-3-4-6-18(17)30(22)23-27-20(24(34-2)8-12-31-13-9-24)19-21(28-23)29-10-14-32-15-16(29)7-11-33-19/h3-6,16H,7-15H2,1-2H3,(H,25,26) |
| InChIKey | DRUKSDUGJFVOJR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |