C21H24N6O5S — CID 86267356
5-methoxy-1-[(10S)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine (PubChem CID 86267356) has the molecular formula C21H24N6O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is 5-methoxy-1-[(10S)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine.
| Compound Name | 5-methoxy-1-[(10S)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 86267356 |
| Molecular Formula | C21H24N6O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 5-methoxy-1-[(10S)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
| SMILES | COc1ccc2c(c1)nc(N)n2-c1nc2c(c(C3(S(C)(=O)=O)CC3)n1)OC[C@@H]1COCCN21 |
| InChI | InChI=1S/C21H24N6O5S/c1-30-13-3-4-15-14(9-13)23-19(22)27(15)20-24-17(21(5-6-21)33(2,28)29)16-18(25-20)26-7-8-31-10-12(26)11-32-16/h3-4,9,12H,5-8,10-11H2,1-2H3,(H2,22,23)/t12-/m0/s1 |
| InChIKey | FEIDGGPQGWVOBE-LBPRGKRZSA-N |
| XLogP | 1.04 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |