C25H30N6O6S — CID 86267355
(10S)-4-(5-methoxy-2-morpholin-4-ylbenzimidazol-1-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86267355) has the molecular formula C25H30N6O6S and a molecular weight of 542.62 g/mol. Its IUPAC name is (10S)-4-(5-methoxy-2-morpholin-4-ylbenzimidazol-1-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-4-(5-methoxy-2-morpholin-4-ylbenzimidazol-1-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86267355 |
| Molecular Formula | C25H30N6O6S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (10S)-4-(5-methoxy-2-morpholin-4-ylbenzimidazol-1-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | COc1ccc2c(c1)nc(N1CCOCC1)n2-c1nc2c(c(C3(S(C)(=O)=O)CC3)n1)OC[C@@H]1COCCN21 |
| InChI | InChI=1S/C25H30N6O6S/c1-34-17-3-4-19-18(13-17)26-24(29-7-10-35-11-8-29)31(19)23-27-21(25(5-6-25)38(2,32)33)20-22(28-23)30-9-12-36-14-16(30)15-37-20/h3-4,13,16H,5-12,14-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | LOAOBUYKXVIPPW-INIZCTEOSA-N |
| XLogP | 1.29 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |