C22H23F2N3O — CID 134311017
4-(2,4-difluorophenoxy)-3-[3-(methylamino)-4-pyrrolidin-1-ylcyclopenta-1,4-dien-1-yl]aniline (PubChem CID 134311017) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-3-[3-(methylamino)-4-pyrrolidin-1-ylcyclopenta-1,4-dien-1-yl]aniline.
| Compound Name | 4-(2,4-difluorophenoxy)-3-[3-(methylamino)-4-pyrrolidin-1-ylcyclopenta-1,4-dien-1-yl]aniline |
|---|---|
| PubChem CID | 134311017 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-3-[3-(methylamino)-4-pyrrolidin-1-ylcyclopenta-1,4-dien-1-yl]aniline |
| SMILES | CNC1C=C(c2cc(N)ccc2Oc2ccc(F)cc2F)C=C1N1CCCC1 |
| InChI | InChI=1S/C22H23F2N3O/c1-26-19-10-14(11-20(19)27-8-2-3-9-27)17-13-16(25)5-7-21(17)28-22-6-4-15(23)12-18(22)24/h4-7,10-13,19,26H,2-3,8-9,25H2,1H3 |
| InChIKey | ALYIKHLHRFLPCP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|