C6H17N3S2 — CID 134314019
(2S)-3-amino-2-[[(2S)-2-amino-3-sulfanylpropyl]amino]propane-1-thiol (PubChem CID 134314019) has the molecular formula C6H17N3S2 and a molecular weight of 195.36 g/mol. Its IUPAC name is (2S)-3-amino-2-[[(2S)-2-amino-3-sulfanylpropyl]amino]propane-1-thiol.
| Compound Name | (2S)-3-amino-2-[[(2S)-2-amino-3-sulfanylpropyl]amino]propane-1-thiol |
|---|---|
| PubChem CID | 134314019 |
| Molecular Formula | C6H17N3S2 |
| Molecular Weight | 195.36 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2S)-3-amino-2-[[(2S)-2-amino-3-sulfanylpropyl]amino]propane-1-thiol |
| SMILES | NC[C@@H](CS)NC[C@H](N)CS |
| InChI | InChI=1S/C6H17N3S2/c7-1-6(4-11)9-2-5(8)3-10/h5-6,9-11H,1-4,7-8H2/t5-,6-/m0/s1 |
| InChIKey | WZYBHVAEWCQAQT-WDSKDSINSA-N |
| XLogP | -0.91 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|