C21H28N2OS — CID 134315120
4-[(1E,3E,5E,7E)-8-(2-hydroxy-6,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-1,3-dihydroimidazole-2-thione (PubChem CID 134315120) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is 4-[(1E,3E,5E,7E)-8-(2-hydroxy-6,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(1E,3E,5E,7E)-8-(2-hydroxy-6,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 134315120 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 4-[(1E,3E,5E,7E)-8-(2-hydroxy-6,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraenyl]-1,3-dihydroimidazole-2-thione |
| SMILES | CC(/C=C/C1=C(O)CCCC1(C)C)=C\C=C\C(C)=C\c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C21H28N2OS/c1-15(10-11-18-19(24)9-6-12-21(18,3)4)7-5-8-16(2)13-17-14-22-20(25)23-17/h5,7-8,10-11,13-14,24H,6,9,12H2,1-4H3,(H2,22,23,25)/b8-5+,11-10+,15-7+,16-13+ |
| InChIKey | LMIIAJVONBKOCR-FCKHSPHMSA-N |
| XLogP | 6.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|