C26H27N7O7S — CID 134320038
(4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate (PubChem CID 134320038) has the molecular formula C26H27N7O7S and a molecular weight of 581.61 g/mol. Its IUPAC name is (4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate.
| Compound Name | (4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate |
|---|---|
| PubChem CID | 134320038 |
| Molecular Formula | C26H27N7O7S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | (4-imidazo[2,1-f]purin-3-yl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate |
| SMILES | CC1(C)OC2C(COS(=O)(=O)NC(=O)CCc3c[nH]c4ccccc34)OC(n3cnc4c3ncn3ccnc43)C2O1 |
| InChI | InChI=1S/C26H27N7O7S/c1-26(2)39-21-18(12-37-41(35,36)31-19(34)8-7-15-11-28-17-6-4-3-5-16(15)17)38-25(22(21)40-26)33-14-29-20-23-27-9-10-32(23)13-30-24(20)33/h3-6,9-11,13-14,18,21-22,25,28H,7-8,12H2,1-2H3,(H,31,34) |
| InChIKey | PKRTZCJTCUPPBK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |