C15H25N — CID 134322726
1,4-diethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine (PubChem CID 134322726) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1,4-diethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine.
| Compound Name | 1,4-diethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 134322726 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1,4-diethyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
| SMILES | CCC1=CN=C(CC)C2CCCCCCC12 |
| InChI | InChI=1S/C15H25N/c1-3-12-11-16-15(4-2)14-10-8-6-5-7-9-13(12)14/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | CXHXTOJIYSYLGE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |