C25H30F3N3O4 — CID 134337196
tert-butyl N-[[2-[3-[(hex-5-ynylamino)-hydroxymethyl]phenoxy]-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate (PubChem CID 134337196) has the molecular formula C25H30F3N3O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is tert-butyl N-[[2-[3-[(hex-5-ynylamino)-hydroxymethyl]phenoxy]-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[3-[(hex-5-ynylamino)-hydroxymethyl]phenoxy]-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 134337196 |
| Molecular Formula | C25H30F3N3O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | tert-butyl N-[[2-[3-[(hex-5-ynylamino)-hydroxymethyl]phenoxy]-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate |
| SMILES | C#CCCCCNC(O)c1cccc(Oc2cc(CNC(=O)OC(C)(C)C)cc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C25H30F3N3O4/c1-5-6-7-8-12-29-22(32)18-10-9-11-19(15-18)34-21-14-17(13-20(31-21)25(26,27)28)16-30-23(33)35-24(2,3)4/h1,9-11,13-15,22,29,32H,6-8,12,16H2,2-4H3,(H,30,33) |
| InChIKey | IDUWLAMTCYLZJP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|