C13H15ClN4O2 — CID 134342695
2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carboxamide (PubChem CID 134342695) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 134342695 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-5-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2cnc(Cl)cc2NC(C)C)nc1C(N)=O |
| InChI | InChI=1S/C13H15ClN4O2/c1-6(2)17-9-4-10(14)16-5-8(9)13-18-11(12(15)19)7(3)20-13/h4-6H,1-3H3,(H2,15,19)(H,16,17) |
| InChIKey | TYYZBFOVVOSUNX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|