C18H25ClN4O2 — CID 141373394
tert-butyl N-[5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrol-3-yl]carbamate (PubChem CID 141373394) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is tert-butyl N-[5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrol-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrol-3-yl]carbamate |
|---|---|
| PubChem CID | 141373394 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl N-[5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrol-3-yl]carbamate |
| SMILES | Cc1[nH]c(-c2cnc(Cl)cc2NC(C)C)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25ClN4O2/c1-10(2)21-15-8-16(19)20-9-12(15)14-7-13(11(3)22-14)23-17(24)25-18(4,5)6/h7-10,22H,1-6H3,(H,20,21)(H,23,24) |
| InChIKey | GQPKVQUFITZRFR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|