C16H20ClN3O2 — CID 141373410
ethyl 5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 141373410) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is ethyl 5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 141373410 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl 5-[6-chloro-4-(propan-2-ylamino)-3-pyridinyl]-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cnc(Cl)cc2NC(C)C)[nH]c1C |
| InChI | InChI=1S/C16H20ClN3O2/c1-5-22-16(21)11-6-13(20-10(11)4)12-8-18-15(17)7-14(12)19-9(2)3/h6-9,20H,5H2,1-4H3,(H,18,19) |
| InChIKey | DCOHSJASYBTFEF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|