C35H27N5O7 — CID 134345882
2-[4-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-2-(6-methylidene-3-oxocyclohexa-1,4-dien-1-yl)oxyphenyl]benzoic acid (PubChem CID 134345882) has the molecular formula C35H27N5O7 and a molecular weight of 629.63 g/mol. Its IUPAC name is 2-[4-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-2-(6-methylidene-3-oxocyclohexa-1,4-dien-1-yl)oxyphenyl]benzoic acid.
| Compound Name | 2-[4-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-2-(6-methylidene-3-oxocyclohexa-1,4-dien-1-yl)oxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 134345882 |
| Molecular Formula | C35H27N5O7 |
| Molecular Weight | 629.63 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | 2-[4-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-2-(6-methylidene-3-oxocyclohexa-1,4-dien-1-yl)oxyphenyl]benzoic acid |
| SMILES | C=C1C=CC(=O)C=C1Oc1cc(N2CCN(C(=O)Cc3cc(=O)oc4cc(N=[N+]=[N-])ccc34)CC2)ccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C35H27N5O7/c1-21-6-9-25(41)20-30(21)46-32-19-24(8-11-28(32)27-4-2-3-5-29(27)35(44)45)39-12-14-40(15-13-39)33(42)16-22-17-34(43)47-31-18-23(37-38-36)7-10-26(22)31/h2-11,17-20H,1,12-16H2,(H,44,45) |
| InChIKey | WUAPJYRJRSLESQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|